cas: 24346-56-3 — see every product listed under this CAS number, including other names
Ethyl 2-benzoylbutanoate, 98% (CAS 24346-56-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1027751-5g |
| cas | 24346-56-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13018.39 Pln | |
| AmBeed | 10g | 19254.97 Pln | |
| Fluorochem | 100mg | 820.56 Pln | |
| Fluorochem | 250mg | 1148.57 Pln | |
| Fluorochem | 500mg | 1965.99 Pln | |
| Fluorochem | 1g | 2507.47 Pln | |
| Fluorochem | 2.5g | 4694.20 Pln | |
| Fluorochem | 5g | 8198.17 Pln | |
| Fluorochem | 10g | 12118.67 Pln | |
| Fluorochem | 25g | 26623.98 Pln | |
| Fluorochem | 100g | 93038.09 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 2-benzoylbutanoate (CAS 24346-56-3) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: ethyl 2-benzoylbutanoate. InChIKey: NZRZNJONGRRTNF-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | ethyl 2-benzoylbutanoate |
| InChIKey | NZRZNJONGRRTNF-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=CC=CC=C1)C(=O)OCC |
Computed by PubChem (NCBI)