CAS 651341-68-3 appears in our catalog under these names: Ethyl 2–bromo–4–fluorobenzoate, Ethyl 2-bromo-4-fluorobenzoate, Benzoic acid, 2-broMo-4-fluoro-, ethyl ester, 95%, 95%, Ethyl 2-bromo-4-fluorobenzoate, 96%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 0,25g, 2,5g, 500g, 1g.
Ethyl 2-bromo-4-fluorobenzoate (CAS 651341-68-3) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: ethyl 2-bromo-4-fluorobenzoate. InChIKey: FYSROUWCKUYSAP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | ethyl 2-bromo-4-fluorobenzoate |
| InChIKey | FYSROUWCKUYSAP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)