cas: 1878-29-1 — see every product listed under this CAS number, including other names
Ethyl 3-(3,4,5-trimethoxyphenyl)acrylate, 95% +(E), 95% +(E) (CAS 1878-29-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GI9-100mg |
| cas | 1878-29-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 606.80 Pln |
| purity | 95% +(E) |
|---|---|
| delivery time | 3 weeks |
Ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (CAS 1878-29-1) is a chemical compound with the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. IUPAC name: ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate. InChIKey: WZFPTWWCXRADLD-VOTSOKGWSA-N.
| Molecular formula | C14H18O5 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | ethyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| InChIKey | WZFPTWWCXRADLD-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)