Products 119293-45-7

CAS 119293-45-7 is the registry number for (4-tert-Butoxycarbonylmethoxy-phenyl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetic acid (CAS 119293-45-7) is a chemical compound with the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. IUPAC name: 2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetic acid. InChIKey: QGEMPYOXGPAGDI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O5
Molecular weight266.29 g/mol
IUPAC name2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetic acid
InChIKeyQGEMPYOXGPAGDI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)COC1=CC=C(C=C1)CC(=O)O

Computed by PubChem (NCBI)