Products 2504202-40-6

CAS 2504202-40-6 is the registry number for 4-(2-Carboxy-ethoxy)-benzoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]propanoic acid (CAS 2504202-40-6) is a chemical compound with the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]propanoic acid. InChIKey: FKCHCKRDULIZMB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O5
Molecular weight266.29 g/mol
IUPAC name3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]propanoic acid
InChIKeyFKCHCKRDULIZMB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=CC=C(C=C1)OCCC(=O)O

Computed by PubChem (NCBI)