cas: 1188263-73-1 — see every product listed under this CAS number, including other names
Ethyl 3-(pyridin-4-ylmethyl)piperidine-3-carboxylate dihydrochloride, 95% (CAS 1188263-73-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A243967-5g |
| cas | 1188263-73-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 23173.99 Pln | |
| AmBeed | 1g | 5824.84 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 3-(pyridin-4-ylmethyl)piperidine-3-carboxylate;dihydrochloride (CAS 1188263-73-1) is a chemical compound with the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: ethyl 3-(pyridin-4-ylmethyl)piperidine-3-carboxylate;dihydrochloride. InChIKey: DRJIODSDSCDAOC-UHFFFAOYSA-N.
| Molecular formula | C14H22Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | ethyl 3-(pyridin-4-ylmethyl)piperidine-3-carboxylate;dihydrochloride |
| InChIKey | DRJIODSDSCDAOC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCCNC1)CC2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)