Products 1172802-40-2

CAS 1172802-40-2 is the registry number for 3-[4-(3-Methylphenyl)piperazin-1-yl]propanoic acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride (CAS 1172802-40-2) is a chemical compound with the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride. InChIKey: IFZYNXNZXSKQEE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22Cl2N2O2
Molecular weight321.2 g/mol
IUPAC name3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride
InChIKeyIFZYNXNZXSKQEE-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)N2CCN(CC2)CCC(=O)O.Cl.Cl

Computed by PubChem (NCBI)