Products 1258725-11-9

CAS 1258725-11-9 appears in our catalog under these names: 4-(4-Phenylpiperazin-1-yl)butanoic acid dihydrochloride, 95%, 4-(4-Phenylpiperazin-1-yl)butanoic acid dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(4-phenylpiperazin-1-yl)butanoic acid;dihydrochloride (CAS 1258725-11-9) is a chemical compound with the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 4-(4-phenylpiperazin-1-yl)butanoic acid;dihydrochloride. InChIKey: XLAWMIBNMKYCFV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22Cl2N2O2
Molecular weight321.2 g/mol
IUPAC name4-(4-phenylpiperazin-1-yl)butanoic acid;dihydrochloride
InChIKeyXLAWMIBNMKYCFV-UHFFFAOYSA-N
SMILESC1CN(CCN1CCCC(=O)O)C2=CC=CC=C2.Cl.Cl

Computed by PubChem (NCBI)