cas: 275826-31-8 — see every product listed under this CAS number, including other names
Ethyl 3-amino-3-(3-bromophenyl)propanoate 95% (CAS 275826-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1038011-100mg |
| cas | 275826-31-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 1888.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1038011 |
Ethyl 3-amino-3-(3-bromophenyl)propanoate (CAS 275826-31-8) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: ethyl 3-amino-3-(3-bromophenyl)propanoate. InChIKey: RRMGYEHLTFAKGC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | ethyl 3-amino-3-(3-bromophenyl)propanoate |
| InChIKey | RRMGYEHLTFAKGC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=CC(=CC=C1)Br)N |
Computed by PubChem (NCBI)