cas: 275826-31-8 — see every product listed under this CAS number, including other names
Ethyl 3-amino-3-(3-bromophenyl)propanoate, 95%, 95% (CAS 275826-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A7NL-100mg |
| cas | 275826-31-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1182.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-amino-3-(3-bromophenyl)propanoate (CAS 275826-31-8) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: ethyl 3-amino-3-(3-bromophenyl)propanoate. InChIKey: RRMGYEHLTFAKGC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | ethyl 3-amino-3-(3-bromophenyl)propanoate |
| InChIKey | RRMGYEHLTFAKGC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=CC(=CC=C1)Br)N |
Computed by PubChem (NCBI)