Products 28033-08-1
CAS 28033-08-1 appears in our catalog under these names: Ethyl 3–amino–6–bromopicolinate, Ethyl 3-amino-6-bromopicolinate, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 3-amino-6-bromopyridine-2-carboxylate (CAS 28033-08-1) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: ethyl 3-amino-6-bromopyridine-2-carboxylate. InChIKey: QZGDHJMYRCGCJG-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | ethyl 3-amino-6-bromopyridine-2-carboxylate |
| InChIKey | QZGDHJMYRCGCJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)Br)N |
Computed by PubChem (NCBI)