CAS 1823895-39-1 appears in our catalog under these names: 2-Amino-5-bromo-4-methyl-nicotinic acid methyl ester, 95%, Methyl 2-amino-5-bromo-4-methylnicotinate 98%, 2-Amino-5-bromo-4-methyl-nicotinic acid methyl ester, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
Methyl 2-amino-5-bromo-4-methylpyridine-3-carboxylate (CAS 1823895-39-1) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: methyl 2-amino-5-bromo-4-methylpyridine-3-carboxylate. InChIKey: DIXIPKFJIROFMK-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | methyl 2-amino-5-bromo-4-methylpyridine-3-carboxylate |
| InChIKey | DIXIPKFJIROFMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)N)C(=O)OC |
Computed by PubChem (NCBI)