Products 108485-08-1

CAS 108485-08-1 is the registry number for N-Ethyl 2-bromo-4-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

2-bromo-N-ethyl-4-nitroaniline (CAS 108485-08-1) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-N-ethyl-4-nitroaniline. InChIKey: XGXMCUACVIEWKI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BrN2O2
Molecular weight245.07 g/mol
IUPAC name2-bromo-N-ethyl-4-nitroaniline
InChIKeyXGXMCUACVIEWKI-UHFFFAOYSA-N
SMILESCCNC1=C(C=C(C=C1)[N+](=O)[O-])Br

Computed by PubChem (NCBI)