cas: 1352200-86-2 — see every product listed under this CAS number, including other names
Ethyl 3-amino-6-chloropicolinate, 95% (CAS 1352200-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F459014-100MG |
| cas | 1352200-86-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 500mg | 1643.19 Pln | |
| Fluorochem | 1g | 2340.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-amino-6-chloropyridine-2-carboxylate (CAS 1352200-86-2) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: ethyl 3-amino-6-chloropyridine-2-carboxylate. InChIKey: QYJWETQREORXMD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | ethyl 3-amino-6-chloropyridine-2-carboxylate |
| InChIKey | QYJWETQREORXMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=N1)Cl)N |
Computed by PubChem (NCBI)