Ethyl 3-bromo-4-(chlorosulfonyl)benzoate, 95%
cas: 1000932-93-3 — see every product listed under this CAS number, including other names
Ethyl 3-bromo-4-(chlorosulfonyl)benzoate, 95% (CAS 1000932-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1090801-100mg |
| cas | 1000932-93-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 348.12 Pln | |
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1989.06 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 2037.20 Pln | |
| BLDpharm | 100mg | 369.89 Pln | |
| BLDpharm | 250mg | 758.65 Pln | |
| BLDpharm | 1g | 2141.49 Pln | |
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 1330.80 Pln | |
| Fluorochem | 1g | 3767.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 3-bromo-4-chlorosulfonylbenzoate (CAS 1000932-93-3) is a chemical compound with the molecular formula C9H8BrClO4S and a molecular weight of 327.58 g/mol. IUPAC name: ethyl 3-bromo-4-chlorosulfonylbenzoate. InChIKey: ORRSZYNOLXITNI-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO4S |
|---|---|
| Molecular weight | 327.58 g/mol |
| IUPAC name | ethyl 3-bromo-4-chlorosulfonylbenzoate |
| InChIKey | ORRSZYNOLXITNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)