Products 1155911-23-1
CAS 1155911-23-1 is the registry number for Ethyl 4-bromo-3-(chlorosulfonyl)benzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 4-bromo-3-chlorosulfonylbenzoate (CAS 1155911-23-1) is a chemical compound with the molecular formula C9H8BrClO4S and a molecular weight of 327.58 g/mol. IUPAC name: ethyl 4-bromo-3-chlorosulfonylbenzoate. InChIKey: CENGDVKYFCXJKP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO4S |
|---|---|
| Molecular weight | 327.58 g/mol |
| IUPAC name | ethyl 4-bromo-3-chlorosulfonylbenzoate |
| InChIKey | CENGDVKYFCXJKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)