Products 1496390-46-5

CAS 1496390-46-5 is the registry number for Ethyl 5-bromo-2-(chlorosulfonyl)benzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-2-chlorosulfonylbenzoate (CAS 1496390-46-5) is a chemical compound with the molecular formula C9H8BrClO4S and a molecular weight of 327.58 g/mol. IUPAC name: ethyl 5-bromo-2-chlorosulfonylbenzoate. InChIKey: ROMOXHGHZAQTKI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClO4S
Molecular weight327.58 g/mol
IUPAC nameethyl 5-bromo-2-chlorosulfonylbenzoate
InChIKeyROMOXHGHZAQTKI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC(=C1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)