Ethyl 3-fluoro-4-nitrobenzoate, 98%
cas: 914347-91-4 — see every product listed under this CAS number, including other names
Ethyl 3-fluoro-4-nitrobenzoate, 98% (CAS 914347-91-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 250mg, 50g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-0272-10g |
| cas | 914347-91-4 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 431.56 Pln | |
| Ambeed | 100g | 1505.12 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 164.41 Pln | |
| BLDpharm | 10g | 242.16 Pln | |
| BLDpharm | 25g | 458.75 Pln | |
| BLDpharm | 100g | 1613.90 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 50g | 568.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Ethyl 3-fluoro-4-nitrobenzoate (CAS 914347-91-4) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 3-fluoro-4-nitrobenzoate. InChIKey: BFEJCZKSFRXXDG-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 3-fluoro-4-nitrobenzoate |
| InChIKey | BFEJCZKSFRXXDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)
