CAS 914347-91-4 appears in our catalog under these names: Ethyl 3-fluoro-4-nitrobenzoate, 98%, Ethyl 3-Fluoro-4-nitrobenzoate, 97%, Ethyl 3-fluoro-4-nitrobenzoate, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 250mg.
Ethyl 3-fluoro-4-nitrobenzoate (CAS 914347-91-4) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 3-fluoro-4-nitrobenzoate. InChIKey: BFEJCZKSFRXXDG-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 3-fluoro-4-nitrobenzoate |
| InChIKey | BFEJCZKSFRXXDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)