CAS 1437780-12-5 is the registry number for Methyl 4-fluoro-5-methyl-2-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-fluoro-5-methyl-2-nitrobenzoate (CAS 1437780-12-5) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: methyl 4-fluoro-5-methyl-2-nitrobenzoate. InChIKey: JTCJXYDXMDXOTG-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | methyl 4-fluoro-5-methyl-2-nitrobenzoate |
| InChIKey | JTCJXYDXMDXOTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)