cas: 13599-24-1 — see every product listed under this CAS number, including other names
Ethyl 3-phenylisoxazole-5-carboxylate, 97%, 97% (CAS 13599-24-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110XCE-100mg |
| cas | 13599-24-1 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 741.20 Pln | |
| Chemat | 10g | 1274.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-phenyl-1,2-oxazole-5-carboxylate (CAS 13599-24-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: ethyl 3-phenyl-1,2-oxazole-5-carboxylate. InChIKey: XYKADOXYAZEDNB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | ethyl 3-phenyl-1,2-oxazole-5-carboxylate |
| InChIKey | XYKADOXYAZEDNB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NO1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)