cas: 19282-45-2 — see every product listed under this CAS number, including other names
Ethyl 4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate, 98% (CAS 19282-45-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338370-1G |
| cas | 19282-45-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 25g | 2559.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (CAS 19282-45-2) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate. InChIKey: BNSTWYGMSUJOFU-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| InChIKey | BNSTWYGMSUJOFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)CCCC2 |
Computed by PubChem (NCBI)