cas: 19282-45-2 — see every product listed under this CAS number, including other names
Ethyl 4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate, 98+%, 98+% (CAS 19282-45-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GDF-10g |
| cas | 19282-45-2 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 885.20 Pln | |
| Chemat | 25g | 1869.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 520.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (CAS 19282-45-2) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate. InChIKey: BNSTWYGMSUJOFU-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | ethyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| InChIKey | BNSTWYGMSUJOFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)CCCC2 |
Computed by PubChem (NCBI)