cas: 6942-61-6 — see every product listed under this CAS number, including other names
Ethyl 4-(4-methylphenyl)-4-oxobutyrate (CAS 6942-61-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F207710-250MG |
| cas | 6942-61-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1065.27 Pln | |
| Fluorochem | 5g | 3689.34 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 4-(4-methylphenyl)-4-oxobutanoate (CAS 6942-61-6) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: ethyl 4-(4-methylphenyl)-4-oxobutanoate. InChIKey: LFHSFGIXTQENJM-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | ethyl 4-(4-methylphenyl)-4-oxobutanoate |
| InChIKey | LFHSFGIXTQENJM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)