Ethyl 4-amino-3,5-dimethylbenzoate, 95+%
cas: 3095-47-4 — see every product listed under this CAS number, including other names
Ethyl 4-amino-3,5-dimethylbenzoate, 95+% (CAS 3095-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A329008-100mg |
| cas | 3095-47-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1799.94 Pln | |
| BLDpharm | 100mg | 464.31 Pln | |
| BLDpharm | 250mg | 703.11 Pln | |
| BLDpharm | 1g | 1769.40 Pln | |
| Fluorochem | 250mg | 1174.60 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Fluorochem | 100mg | 726.85 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 4-amino-3,5-dimethylbenzoate (CAS 3095-47-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: ethyl 4-amino-3,5-dimethylbenzoate. InChIKey: GEMKGDSDLYAIRK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | ethyl 4-amino-3,5-dimethylbenzoate |
| InChIKey | GEMKGDSDLYAIRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)N)C |
Computed by PubChem (NCBI)