cas: 24755-82-6 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-2-phenyl-5-pyrimidinecarboxylate, 95% (CAS 24755-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049552-100MG |
| cas | 24755-82-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 3434.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-chloro-2-phenylpyrimidine-5-carboxylate (CAS 24755-82-6) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: ethyl 4-chloro-2-phenylpyrimidine-5-carboxylate. InChIKey: VXWYTPARKVGWFX-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | ethyl 4-chloro-2-phenylpyrimidine-5-carboxylate |
| InChIKey | VXWYTPARKVGWFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)