CAS 67990-66-3 appears in our catalog under these names: N-(2-Amino-4-chlorophenyl)anthranilic acid, 95%, Clozapine Impurity 8, N-(2-AMINO-4-CHLOROPHENYL)ANTHRANILIC &, 2-((2-Amino-4-chlorophenyl)amino)benzoic acid, 97%, 97%, 2-((2-Amino-4-chlorophenyl)amino)benzoic acid, 97%. Offered by: Combi-blocks, Chemat Brand, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, on request, 5g.
2-(2-amino-4-chloroanilino)benzoic acid (CAS 67990-66-3) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 2-(2-amino-4-chloroanilino)benzoic acid. InChIKey: HMVPMZFEYCGSTC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-(2-amino-4-chloroanilino)benzoic acid |
| InChIKey | HMVPMZFEYCGSTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)