CAS 2416673-66-8 is the registry number for 2-(3-Chlorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carboxylic acid (CAS 2416673-66-8) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carboxylic acid. InChIKey: GDQVHRGAXMWFQU-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carboxylic acid |
| InChIKey | GDQVHRGAXMWFQU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NN2C1)C3=CC(=CC=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)