cas: 1196152-94-9 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-5-nitropicolinate 97% (CAS 1196152-94-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1150524-50mg |
| cas | 1196152-94-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 759.75 Pln | |
| Ambeed | 100mg | 904.38 Pln | |
| Ambeed | 250mg | 1627.50 Pln | |
| Ambeed | 1g | 5727.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1150524 |
Ethyl 4-chloro-5-nitropyridine-2-carboxylate (CAS 1196152-94-9) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: ethyl 4-chloro-5-nitropyridine-2-carboxylate. InChIKey: JGXIYZGUFNXWJE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | ethyl 4-chloro-5-nitropyridine-2-carboxylate |
| InChIKey | JGXIYZGUFNXWJE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C(=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)