Products 1616257-07-8
CAS 1616257-07-8 is the registry number for methyl 4-amino-2-chloro-5-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Methyl 4-amino-2-chloro-5-nitrobenzoate (CAS 1616257-07-8) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: methyl 4-amino-2-chloro-5-nitrobenzoate. InChIKey: SDLVVWSGANTRFZ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | methyl 4-amino-2-chloro-5-nitrobenzoate |
| InChIKey | SDLVVWSGANTRFZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)