Products 2092000-50-3
CAS 2092000-50-3 is the registry number for N-(2-Chloro-5-hydroxy-4-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(2-chloro-5-hydroxy-4-nitrophenyl)acetamide (CAS 2092000-50-3) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: N-(2-chloro-5-hydroxy-4-nitrophenyl)acetamide. InChIKey: LQMRAUOCNZMDNH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | N-(2-chloro-5-hydroxy-4-nitrophenyl)acetamide |
| InChIKey | LQMRAUOCNZMDNH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)