cas: 103514-54-1 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-6-nitroquinoline-3-carboxylate, 97% (CAS 103514-54-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A574871-5g |
| cas | 103514-54-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12686.38 Pln | |
| AmBeed | 10g | 21019.18 Pln | |
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 2778.21 Pln | |
| Fluorochem | 5g | 12431.06 Pln | |
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 2171.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 4-chloro-6-nitroquinoline-3-carboxylate (CAS 103514-54-1) is a chemical compound with the molecular formula C12H9ClN2O4 and a molecular weight of 280.66 g/mol. IUPAC name: ethyl 4-chloro-6-nitroquinoline-3-carboxylate. InChIKey: UYLBXSAYGSUOJS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O4 |
|---|---|
| Molecular weight | 280.66 g/mol |
| IUPAC name | ethyl 4-chloro-6-nitroquinoline-3-carboxylate |
| InChIKey | UYLBXSAYGSUOJS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C=CC(=CC2=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)