CAS 1622069-59-3 is the registry number for Methyl ([3-(4-chlorophenyl)-1,2-oxazol-5-yl]carbamoyl)formate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-2-oxoacetate (CAS 1622069-59-3) is a chemical compound with the molecular formula C12H9ClN2O4 and a molecular weight of 280.66 g/mol. IUPAC name: methyl 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-2-oxoacetate. InChIKey: FULXRVZIYUFMAN-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O4 |
|---|---|
| Molecular weight | 280.66 g/mol |
| IUPAC name | methyl 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-2-oxoacetate |
| InChIKey | FULXRVZIYUFMAN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)NC1=CC(=NO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)