CAS 131548-98-6 appears in our catalog under these names: Ethyl 4-chloro-8-nitroquinoline-3-carboxylate, 95%, Ethyl 4–chloro–8–nitroquinoline–3–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 4-chloro-8-nitroquinoline-3-carboxylate (CAS 131548-98-6) is a chemical compound with the molecular formula C12H9ClN2O4 and a molecular weight of 280.66 g/mol. IUPAC name: ethyl 4-chloro-8-nitroquinoline-3-carboxylate. InChIKey: UVMXISWKXFDSGZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O4 |
|---|---|
| Molecular weight | 280.66 g/mol |
| IUPAC name | ethyl 4-chloro-8-nitroquinoline-3-carboxylate |
| InChIKey | UVMXISWKXFDSGZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)