Ethyl 4-chloroquinazoline-6-carboxylate, 95%
cas: 155960-94-4 — see every product listed under this CAS number, including other names
Ethyl 4-chloroquinazoline-6-carboxylate, 95% (CAS 155960-94-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F216390-250MG |
| cas | 155960-94-4 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1205.84 Pln | |
| Fluorochem | 1g | 3434.23 Pln | |
| Fluorochem | 5g | 9942.35 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2389.56 Pln | |
| Ambeed | 5g | 7028.69 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2397.20 Pln | |
| Chemat | 5g | 7067.60 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 891.93 Pln | |
| BLDpharm | 1g | 2569.12 Pln | |
| BLDpharm | 5g | 7572.91 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Ethyl 4-chloroquinazoline-6-carboxylate (CAS 155960-94-4) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: ethyl 4-chloroquinazoline-6-carboxylate. InChIKey: ADKCJHRCXSXELJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | ethyl 4-chloroquinazoline-6-carboxylate |
| InChIKey | ADKCJHRCXSXELJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=CN=C2Cl |
Computed by PubChem (NCBI)