CAS 1015868-48-0 appears in our catalog under these names: 3-(4-Chlorophenyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 95%, 3–(4–Chlorophenyl)–1–methyl–1H–pyrazole–5–carboxylic acid, 5-(4-Chloro-phenyl)-2-methyl-2H-pyrazole-3-carboxylic acid, 3-(4-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 98%, 98%, 5-(4-Chloro-phenyl)-2-methyl-2H-pyrazole, -3-carboxylic acid, 50 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 10g, 5g.
3-(4-chlorophenyl)-1-methylpyrazole-5-carboxylic acid (CAS 1015868-48-0) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 3-(4-chlorophenyl)-1-methylpyrazole-5-carboxylic acid. InChIKey: JNOADCITUCNMIN-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1-methylpyrazole-5-carboxylic acid |
| InChIKey | JNOADCITUCNMIN-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)