CAS 351003-20-8 is the registry number for 6-Chloro-2,3-dihydro-3-oxo-4h-1,4-benzoxazine-4-propionitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)propanenitrile (CAS 351003-20-8) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 3-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)propanenitrile. InChIKey: WLSJNBIUCRGWQJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 3-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)propanenitrile |
| InChIKey | WLSJNBIUCRGWQJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=CC(=C2)Cl)CCC#N |
Computed by PubChem (NCBI)