cas: 1126479-87-5 — see every product listed under this CAS number, including other names
Ethyl 4-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95% (CAS 1126479-87-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A932902-100mg |
| cas | 1126479-87-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 2612.06 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 925.25 Pln | |
| BLDpharm | 5g | 2807.92 Pln | |
| Fluorochem | 5g | 6386.31 Pln | |
| Fluorochem | 1g | 1700.46 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 4-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1126479-87-5) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: ethyl 4-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: BGUQZJGZONTJGU-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | ethyl 4-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | BGUQZJGZONTJGU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OCC)C#N |
Computed by PubChem (NCBI)