cas: 19013-10-6 — see every product listed under this CAS number, including other names
Ethyl 4-hydroxy-3-nitrobenzoate, 95%, 95% (CAS 19013-10-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ED2-25g |
| cas | 19013-10-6 |
| size | 25g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1350.80 Pln | |
| Chemat | 1g | 242.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-hydroxy-3-nitrobenzoate (CAS 19013-10-6) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: ethyl 4-hydroxy-3-nitrobenzoate. InChIKey: FBHJNBWUGONVNS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | ethyl 4-hydroxy-3-nitrobenzoate |
| InChIKey | FBHJNBWUGONVNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)