cas: 741709-57-9 — see every product listed under this CAS number, including other names
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate 97% (CAS 741709-57-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199228-250mg |
| cas | 741709-57-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 10g | 1354.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199228 |
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 741709-57-9) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: LARSIMPPYZOXGK-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | LARSIMPPYZOXGK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)