Ethyl 5-(4-fluorophenyl)oxazole-2-carboxylate, 95%
cas: 21717-99-7 — see every product listed under this CAS number, including other names
Ethyl 5-(4-fluorophenyl)oxazole-2-carboxylate, 95% (CAS 21717-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A683920-100mg |
| cas | 21717-99-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1644.19 Pln | |
| Ambeed | 5g | 4258.56 Pln | |
| Ambeed | 10g | 6867.38 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 625.36 Pln | |
| BLDpharm | 1g | 1769.40 Pln | |
| BLDpharm | 5g | 4590.63 Pln | |
| BLDpharm | 10g | 7400.75 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 1576.40 Pln | |
| Chemat | 5g | 4072.40 Pln | |
| Chemat | 10g | 6477.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 5-(4-fluorophenyl)-1,3-oxazole-2-carboxylate (CAS 21717-99-7) is a chemical compound with the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. IUPAC name: ethyl 5-(4-fluorophenyl)-1,3-oxazole-2-carboxylate. InChIKey: LDOGOQBEYDOXAT-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO3 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | ethyl 5-(4-fluorophenyl)-1,3-oxazole-2-carboxylate |
| InChIKey | LDOGOQBEYDOXAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(O1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)