CAS 371157-14-1 is the registry number for Ethyl 5-(3-fluorophenyl)isoxazole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(3-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS 371157-14-1) is a chemical compound with the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. IUPAC name: ethyl 5-(3-fluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: STKHVSUVJQOXSL-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO3 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | ethyl 5-(3-fluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | STKHVSUVJQOXSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)