CAS 301823-79-0 is the registry number for 4-Ethoxy-6-fluoroquinoline-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-ethoxy-6-fluoroquinoline-2-carboxylic acid (CAS 301823-79-0) is a chemical compound with the molecular formula C12H10FNO3 and a molecular weight of 235.21 g/mol. IUPAC name: 4-ethoxy-6-fluoroquinoline-2-carboxylic acid. InChIKey: LYKMRHYNUIXZLT-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO3 |
|---|---|
| Molecular weight | 235.21 g/mol |
| IUPAC name | 4-ethoxy-6-fluoroquinoline-2-carboxylic acid |
| InChIKey | LYKMRHYNUIXZLT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=NC2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)