Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate, 97%
cas: 851725-98-9 — see every product listed under this CAS number, including other names
Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate, 97% (CAS 851725-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F720334-100MG |
| cas | 851725-98-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 2823.44 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2709.20 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 3035.62 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Ethyl 5-(difluoromethyl)-1-methylpyrazole-4-carboxylate (CAS 851725-98-9) is a chemical compound with the molecular formula C8H10F2N2O2 and a molecular weight of 204.17 g/mol. IUPAC name: ethyl 5-(difluoromethyl)-1-methylpyrazole-4-carboxylate. InChIKey: AYCXDJXKBPZTTR-UHFFFAOYSA-N.
| Molecular formula | C8H10F2N2O2 |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | ethyl 5-(difluoromethyl)-1-methylpyrazole-4-carboxylate |
| InChIKey | AYCXDJXKBPZTTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C)C(F)F |
Computed by PubChem (NCBI)