Products 1286792-87-7
CAS 1286792-87-7 is the registry number for Ethyl difluoro(4-methylpyrazole-5-yl)acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 5g.
Ethyl 2,2-difluoro-2-(4-methyl-1H-pyrazol-5-yl)acetate (CAS 1286792-87-7) is a chemical compound with the molecular formula C8H10F2N2O2 and a molecular weight of 204.17 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(4-methyl-1H-pyrazol-5-yl)acetate. InChIKey: SLOPSSMOOCXEKH-UHFFFAOYSA-N.
| Molecular formula | C8H10F2N2O2 |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(4-methyl-1H-pyrazol-5-yl)acetate |
| InChIKey | SLOPSSMOOCXEKH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=NN1)C)(F)F |
Computed by PubChem (NCBI)