CAS 1221724-52-2 appears in our catalog under these names: 2-[1-(Difluoromethyl)-3,5-dimethyl-1h-pyrazol-4-yl]acetic acid, 95%, 2-(1-(Difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid, 95%, 2-(1-(Difluoromethyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetic acid (CAS 1221724-52-2) is a chemical compound with the molecular formula C8H10F2N2O2 and a molecular weight of 204.17 g/mol. IUPAC name: 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetic acid. InChIKey: FVFASAFOCBCBNF-UHFFFAOYSA-N.
| Molecular formula | C8H10F2N2O2 |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | 2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetic acid |
| InChIKey | FVFASAFOCBCBNF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(F)F)C)CC(=O)O |
Computed by PubChem (NCBI)