cas: 181803-33-8 — see every product listed under this CAS number, including other names
Ethyl 5-(tert-butyl)-1,3,4-oxadiazole-2-carboxylate, 97%, 97% (CAS 181803-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11344W-100mg |
| cas | 181803-33-8 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 808.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate (CAS 181803-33-8) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: ethyl 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate. InChIKey: XRRWIQFBADWOLM-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | ethyl 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | XRRWIQFBADWOLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C(C)(C)C |
Computed by PubChem (NCBI)