cas: 714273-89-9 — see every product listed under this CAS number, including other names
Ethyl 5-(tert-butyl)oxazole-4-carboxylate, 98% (CAS 714273-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720205-100MG |
| cas | 714273-89-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 1049.65 Pln | |
| Fluorochem | 5g | 3330.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-tert-butyl-1,3-oxazole-4-carboxylate (CAS 714273-89-9) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: ethyl 5-tert-butyl-1,3-oxazole-4-carboxylate. InChIKey: YVBVIJQMJDNVFD-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | ethyl 5-tert-butyl-1,3-oxazole-4-carboxylate |
| InChIKey | YVBVIJQMJDNVFD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC=N1)C(C)(C)C |
Computed by PubChem (NCBI)