cas: 15001-11-3 — see every product listed under this CAS number, including other names
Ethyl 5-amino-1-(p-tolyl)-1H-pyrazole-4-carboxylate, 98% (CAS 15001-11-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F336084-1G |
| cas | 15001-11-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 789.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-amino-1-(4-methylphenyl)pyrazole-4-carboxylate (CAS 15001-11-3) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: ethyl 5-amino-1-(4-methylphenyl)pyrazole-4-carboxylate. InChIKey: HYLAFESEWXPMFD-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | ethyl 5-amino-1-(4-methylphenyl)pyrazole-4-carboxylate |
| InChIKey | HYLAFESEWXPMFD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=C(C=C2)C)N |
Computed by PubChem (NCBI)