Products 1500513-55-2
CAS 1500513-55-2 is the registry number for 3-Benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione (CAS 1500513-55-2) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 3-benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione. InChIKey: PHBRFBNKYAQDFL-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 3-benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| InChIKey | PHBRFBNKYAQDFL-UHFFFAOYSA-N |
| SMILES | C1CNCC12C(=O)N(C(=O)N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)